C30H40FN3O4S — CID 134146450
(2S)-2-[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-4-methyl-5-[[methyl(2-piperidin-4-ylethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 134146450) has the molecular formula C30H40FN3O4S and a molecular weight of 557.73 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-4-methyl-5-[[methyl(2-piperidin-4-ylethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-4-methyl-5-[[methyl(2-piperidin-4-ylethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 134146450 |
| Molecular Formula | C30H40FN3O4S |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | (2S)-2-[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-4-methyl-5-[[methyl(2-piperidin-4-ylethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#Cc3cccc(F)c3)cc2O[C@H]1CN(C)CCC1CCNCC1 |
| InChI | InChI=1S/C30H40FN3O4S/c1-22-19-34(23(2)21-35)39(36,37)30-10-9-26(8-7-25-5-4-6-27(31)17-25)18-28(30)38-29(22)20-33(3)16-13-24-11-14-32-15-12-24/h4-6,9-10,17-18,22-24,29,32,35H,11-16,19-21H2,1-3H3/t22-,23+,29+/m1/s1 |
| InChIKey | AJTARHFVCBQDLT-AFKLWXAFSA-N |
| XLogP | 3.32 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|