C31H40FN3O5S — CID 134153864
3-(cyclohexylmethyl)-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 134153864) has the molecular formula C31H40FN3O5S and a molecular weight of 585.74 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-(cyclohexylmethyl)-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 134153864 |
| Molecular Formula | C31H40FN3O5S |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 3-(cyclohexylmethyl)-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#Cc3cccc(F)c3)cc2O[C@H]1CN(C)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C31H40FN3O5S/c1-22-19-35(23(2)21-36)41(38,39)30-15-14-25(13-12-24-10-7-11-27(32)16-24)17-28(30)40-29(22)20-34(3)31(37)33-18-26-8-5-4-6-9-26/h7,10-11,14-17,22-23,26,29,36H,4-6,8-9,18-21H2,1-3H3,(H,33,37)/t22-,23+,29+/m1/s1 |
| InChIKey | CJBCYXRMZURCBY-AFKLWXAFSA-N |
| XLogP | 4.22 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|