C30H38FN3O5S — CID 54631126
3-cyclohexyl-1-[[(4R,5R)-8-[2-(4-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 54631126) has the molecular formula C30H38FN3O5S and a molecular weight of 571.72 g/mol. Its IUPAC name is 3-cyclohexyl-1-[[(4R,5R)-8-[2-(4-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-cyclohexyl-1-[[(4R,5R)-8-[2-(4-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 54631126 |
| Molecular Formula | C30H38FN3O5S |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 3-cyclohexyl-1-[[(4R,5R)-8-[2-(4-fluorophenyl)ethynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#Cc3ccc(F)cc3)cc2O[C@H]1CN(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H38FN3O5S/c1-21-18-34(22(2)20-35)40(37,38)29-16-13-24(10-9-23-11-14-25(31)15-12-23)17-27(29)39-28(21)19-33(3)30(36)32-26-7-5-4-6-8-26/h11-17,21-22,26,28,35H,4-8,18-20H2,1-3H3,(H,32,36)/t21-,22-,28+/m1/s1 |
| InChIKey | VEGIXFNIVQHFBU-XJGOYTCSSA-N |
| XLogP | 3.97 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|