C29H36FN3O6S — CID 54621126
3-(4-fluorophenyl)-1-[[(4S,5S)-8-[2-(1-hydroxycyclopentyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 54621126) has the molecular formula C29H36FN3O6S and a molecular weight of 573.69 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[[(4S,5S)-8-[2-(1-hydroxycyclopentyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-(4-fluorophenyl)-1-[[(4S,5S)-8-[2-(1-hydroxycyclopentyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 54621126 |
| Molecular Formula | C29H36FN3O6S |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[[(4S,5S)-8-[2-(1-hydroxycyclopentyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | C[C@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#CC3(O)CCCC3)cc2O[C@@H]1CN(C)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H36FN3O6S/c1-20-17-33(21(2)19-34)40(37,38)27-11-6-22(12-15-29(36)13-4-5-14-29)16-25(27)39-26(20)18-32(3)28(35)31-24-9-7-23(30)8-10-24/h6-11,16,20-21,26,34,36H,4-5,13-14,17-19H2,1-3H3,(H,31,35)/t20-,21-,26+/m0/s1 |
| InChIKey | VKNIOIDXUYQURP-ISJBWFOZSA-N |
| XLogP | 3.41 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|