C23H34N2O5S — CID 54623624
1-[2-[(4R,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]ethynyl]cyclopentan-1-ol (PubChem CID 54623624) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is 1-[2-[(4R,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[(4R,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 54623624 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[2-[(4R,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]ethynyl]cyclopentan-1-ol |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#CC3(O)CCCC3)cc2O[C@@H]1CN(C)C |
| InChI | InChI=1S/C23H34N2O5S/c1-17-14-25(18(2)16-26)31(28,29)22-8-7-19(9-12-23(27)10-5-6-11-23)13-20(22)30-21(17)15-24(3)4/h7-8,13,17-18,21,26-27H,5-6,10-11,14-16H2,1-4H3/t17-,18-,21-/m1/s1 |
| InChIKey | FOOMCEDJUHJRLO-DBXWQHBBSA-N |
| XLogP | 1.67 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|