C24H36N2O4S — CID 54623889
(2R)-2-[(4R,5R)-8-(3-cyclopentylprop-1-ynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54623889) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-8-(3-cyclopentylprop-1-ynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5R)-8-(3-cyclopentylprop-1-ynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54623889 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (2R)-2-[(4R,5R)-8-(3-cyclopentylprop-1-ynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#CCC3CCCC3)cc2O[C@H]1CN(C)C |
| InChI | InChI=1S/C24H36N2O4S/c1-18-15-26(19(2)17-27)31(28,29)24-13-12-21(11-7-10-20-8-5-6-9-20)14-22(24)30-23(18)16-25(3)4/h12-14,18-20,23,27H,5-6,8-10,15-17H2,1-4H3/t18-,19-,23+/m1/s1 |
| InChIKey | CFTRXLOSJAAWIY-PWHSHALESA-N |
| XLogP | 2.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|