C21H30N2O4S — CID 54627861
(2R)-2-[(4S,5S)-8-(2-cyclopropylethynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54627861) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-8-(2-cyclopropylethynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5S)-8-(2-cyclopropylethynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54627861 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (2R)-2-[(4S,5S)-8-(2-cyclopropylethynyl)-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C)Oc2cc(C#CC3CC3)ccc2S1(=O)=O |
| InChI | InChI=1S/C21H30N2O4S/c1-15-12-23(16(2)14-24)28(25,26)21-10-9-18(8-7-17-5-6-17)11-19(21)27-20(15)13-22(3)4/h9-11,15-17,20,24H,5-6,12-14H2,1-4H3/t15-,16+,20+/m0/s1 |
| InChIKey | YSSZQGHVSYAIPH-RZQQEMMASA-N |
| XLogP | 1.78 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|