C27H34N2O4S — CID 54625696
(2S)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(2-cyclopropylethynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54625696) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(2-cyclopropylethynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(2-cyclopropylethynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54625696 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2S)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(2-cyclopropylethynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#CC3CC3)cc2O[C@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4S/c1-20-16-29(21(2)19-30)34(31,32)27-14-13-23(12-11-22-9-10-22)15-25(27)33-26(20)18-28(3)17-24-7-5-4-6-8-24/h4-8,13-15,20-22,26,30H,9-10,16-19H2,1-3H3/t20-,21+,26+/m1/s1 |
| InChIKey | IKKPAINHCJPYFK-SWYRRKHMSA-N |
| XLogP | 3.35 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|