C26H34N2O5S — CID 54626052
(2R)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54626052) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54626052 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-[[benzyl(methyl)amino]methyl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | COCC#Cc1ccc2c(c1)O[C@@H](CN(C)Cc1ccccc1)[C@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C26H34N2O5S/c1-20-16-28(21(2)19-29)34(30,31)26-13-12-22(11-8-14-32-4)15-24(26)33-25(20)18-27(3)17-23-9-6-5-7-10-23/h5-7,9-10,12-13,15,20-21,25,29H,14,16-19H2,1-4H3/t20-,21-,25+/m1/s1 |
| InChIKey | XXFQEROVZJYNRO-OTPAQWSUSA-N |
| XLogP | 2.59 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|