C20H30N2O7S2 — CID 54621793
N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 54621793) has the molecular formula C20H30N2O7S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 54621793 |
| Molecular Formula | C20H30N2O7S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | COCC#Cc1ccc2c(c1)O[C@H](CN(C)S(C)(=O)=O)[C@H](C)CN([C@@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C20H30N2O7S2/c1-15-12-22(16(2)14-23)31(26,27)20-9-8-17(7-6-10-28-4)11-18(20)29-19(15)13-21(3)30(5,24)25/h8-9,11,15-16,19,23H,10,12-14H2,1-5H3/t15-,16+,19-/m1/s1 |
| InChIKey | FSZZBTJTBAEZDV-JTDSTZFVSA-N |
| XLogP | 0.34 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|