C21H32N2O6S2 — CID 54624715
N-[[(4S,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 54624715) has the molecular formula C21H32N2O6S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[[(4S,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[(4S,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 54624715 |
| Molecular Formula | C21H32N2O6S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[[(4S,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CC(C)C#Cc1ccc2c(c1)O[C@@H](CN(C)S(C)(=O)=O)[C@@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C21H32N2O6S2/c1-15(2)7-8-18-9-10-21-19(11-18)29-20(13-22(5)30(6,25)26)16(3)12-23(17(4)14-24)31(21,27)28/h9-11,15-17,20,24H,12-14H2,1-6H3/t16-,17+,20-/m0/s1 |
| InChIKey | VHGAJMCCLUAAOB-QKLQHJQFSA-N |
| XLogP | 1.35 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|