C20H30N2O4S — CID 54629767
(2R)-2-[(4S,5S)-4-methyl-5-(methylaminomethyl)-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54629767) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-4-methyl-5-(methylaminomethyl)-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5S)-4-methyl-5-(methylaminomethyl)-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54629767 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2R)-2-[(4S,5S)-4-methyl-5-(methylaminomethyl)-8-(3-methylbut-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | CNC[C@H]1Oc2cc(C#CC(C)C)ccc2S(=O)(=O)N([C@H](C)CO)C[C@@H]1C |
| InChI | InChI=1S/C20H30N2O4S/c1-14(2)6-7-17-8-9-20-18(10-17)26-19(11-21-5)15(3)12-22(16(4)13-23)27(20,24)25/h8-10,14-16,19,21,23H,11-13H2,1-5H3/t15-,16+,19+/m0/s1 |
| InChIKey | FVPRNHSCTDTKKY-FRQCXROJSA-N |
| XLogP | 1.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|