C21H32N2O6S2 — CID 54620950
N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 54620950) has the molecular formula C21H32N2O6S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 54620950 |
| Molecular Formula | C21H32N2O6S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CCCC#Cc1ccc2c(c1)O[C@@H](CN(C)S(C)(=O)=O)[C@H](C)CN([C@@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C21H32N2O6S2/c1-6-7-8-9-18-10-11-21-19(12-18)29-20(14-22(4)30(5,25)26)16(2)13-23(17(3)15-24)31(21,27)28/h10-12,16-17,20,24H,6-7,13-15H2,1-5H3/t16-,17+,20+/m1/s1 |
| InChIKey | PIGCWIWXUYKFRH-UWVAXJGDSA-N |
| XLogP | 1.50 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|