C26H33FN2O6S2 — CID 54624919
3-fluoro-N-[[(4S,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide (PubChem CID 54624919) has the molecular formula C26H33FN2O6S2 and a molecular weight of 552.69 g/mol. Its IUPAC name is 3-fluoro-N-[[(4S,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-[[(4S,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54624919 |
| Molecular Formula | C26H33FN2O6S2 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 3-fluoro-N-[[(4S,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide |
| SMILES | CCCC#Cc1ccc2c(c1)O[C@H](CN(C)S(=O)(=O)c1cccc(F)c1)[C@@H](C)CN([C@@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C26H33FN2O6S2/c1-5-6-7-9-21-12-13-26-24(14-21)35-25(19(2)16-29(20(3)18-30)37(26,33)34)17-28(4)36(31,32)23-11-8-10-22(27)15-23/h8,10-15,19-20,25,30H,5-6,16-18H2,1-4H3/t19-,20-,25+/m0/s1 |
| InChIKey | VKCNHHFTJQKZFH-ZYLNGJIFSA-N |
| XLogP | 3.07 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|