C26H34N2O7S2 — CID 54627417
N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 54627417) has the molecular formula C26H34N2O7S2 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 54627417 |
| Molecular Formula | C26H34N2O7S2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | N-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-8-(3-methoxyprop-1-ynyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | COCC#Cc1ccc2c(c1)O[C@H](CN(C)S(=O)(=O)c1ccc(C)cc1)[C@@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C26H34N2O7S2/c1-19-8-11-23(12-9-19)36(30,31)27(4)17-25-20(2)16-28(21(3)18-29)37(32,33)26-13-10-22(7-6-14-34-5)15-24(26)35-25/h8-13,15,20-21,25,29H,14,16-18H2,1-5H3/t20-,21+,25+/m0/s1 |
| InChIKey | UHTWELFHWWILSH-BPYKYCOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|