C30H40N2O7S2 — CID 46903417
N-[[(4S,5R)-8-(2-cyclohexylethynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 46903417) has the molecular formula C30H40N2O7S2 and a molecular weight of 604.79 g/mol. Its IUPAC name is N-[[(4S,5R)-8-(2-cyclohexylethynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[[(4S,5R)-8-(2-cyclohexylethynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46903417 |
| Molecular Formula | C30H40N2O7S2 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | N-[[(4S,5R)-8-(2-cyclohexylethynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C[C@@H]2Oc3cc(C#CC4CCCCC4)ccc3S(=O)(=O)N([C@@H](C)CO)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C30H40N2O7S2/c1-22-19-32(23(2)21-33)41(36,37)30-17-12-25(11-10-24-8-6-5-7-9-24)18-28(30)39-29(22)20-31(3)40(34,35)27-15-13-26(38-4)14-16-27/h12-18,22-24,29,33H,5-9,19-21H2,1-4H3/t22-,23-,29-/m0/s1 |
| InChIKey | GJYQGCNSYJSQHS-BOSRLCDASA-N |
| XLogP | 3.72 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|