C28H30FN3O6S2 — CID 54627938
4-fluoro-N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-pyridin-4-ylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide (PubChem CID 54627938) has the molecular formula C28H30FN3O6S2 and a molecular weight of 587.70 g/mol. Its IUPAC name is 4-fluoro-N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-pyridin-4-ylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-pyridin-4-ylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54627938 |
| Molecular Formula | C28H30FN3O6S2 |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 4-fluoro-N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-(2-pyridin-4-ylethynyl)-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzenesulfonamide |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#Cc3ccncc3)cc2O[C@@H]1CN(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H30FN3O6S2/c1-20-17-32(21(2)19-33)40(36,37)28-11-6-23(5-4-22-12-14-30-15-13-22)16-26(28)38-27(20)18-31(3)39(34,35)25-9-7-24(29)8-10-25/h6-16,20-21,27,33H,17-19H2,1-3H3/t20-,21+,27-/m1/s1 |
| InChIKey | YKPSJTGOQQELHG-PBDKAQRYSA-N |
| XLogP | 2.71 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|