C28H37FN2O4S — CID 54630997
(2R)-2-[(4S,5R)-5-[[(4-fluorophenyl)methyl-methylamino]methyl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54630997) has the molecular formula C28H37FN2O4S and a molecular weight of 516.68 g/mol. Its IUPAC name is (2R)-2-[(4S,5R)-5-[[(4-fluorophenyl)methyl-methylamino]methyl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5R)-5-[[(4-fluorophenyl)methyl-methylamino]methyl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54630997 |
| Molecular Formula | C28H37FN2O4S |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (2R)-2-[(4S,5R)-5-[[(4-fluorophenyl)methyl-methylamino]methyl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | CC(C)CC#Cc1ccc2c(c1)O[C@@H](CN(C)Cc1ccc(F)cc1)[C@@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C28H37FN2O4S/c1-20(2)7-6-8-23-11-14-28-26(15-23)35-27(18-30(5)17-24-9-12-25(29)13-10-24)21(3)16-31(22(4)19-32)36(28,33)34/h9-15,20-22,27,32H,7,16-19H2,1-5H3/t21-,22+,27-/m0/s1 |
| InChIKey | FDGHAWSAFBNHNV-XXAUWVGASA-N |
| XLogP | 4.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|