C27H37N3O4S — CID 54622913
(2R)-2-[(4S,5S)-4-methyl-8-(4-methylpent-1-ynyl)-5-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54622913) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-4-methyl-8-(4-methylpent-1-ynyl)-5-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5S)-4-methyl-8-(4-methylpent-1-ynyl)-5-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54622913 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (2R)-2-[(4S,5S)-4-methyl-8-(4-methylpent-1-ynyl)-5-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | CC(C)CC#Cc1ccc2c(c1)O[C@H](CN(C)Cc1cccnc1)[C@@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C27H37N3O4S/c1-20(2)8-6-9-23-11-12-27-25(14-23)34-26(18-29(5)17-24-10-7-13-28-15-24)21(3)16-30(22(4)19-31)35(27,32)33/h7,10-15,20-22,26,31H,8,16-19H2,1-5H3/t21-,22+,26+/m0/s1 |
| InChIKey | CQDGJKUNMXGLJW-VVZHRXSXSA-N |
| XLogP | 3.38 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|