C27H32FN3O5S — CID 134140713
3-cyclopropyl-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 134140713) has the molecular formula C27H32FN3O5S and a molecular weight of 529.63 g/mol. Its IUPAC name is 3-cyclopropyl-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-cyclopropyl-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 134140713 |
| Molecular Formula | C27H32FN3O5S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 3-cyclopropyl-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#Cc3cccc(F)c3)cc2O[C@H]1CN(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C27H32FN3O5S/c1-18-15-31(19(2)17-32)37(34,35)26-12-9-21(8-7-20-5-4-6-22(28)13-20)14-24(26)36-25(18)16-30(3)27(33)29-23-10-11-23/h4-6,9,12-14,18-19,23,25,32H,10-11,15-17H2,1-3H3,(H,29,33)/t18-,19+,25+/m1/s1 |
| InChIKey | ZSZSGOJOARTCCJ-WYEJZRMESA-N |
| XLogP | 2.80 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|