C28H39N5O5S — CID 134153452
3-cyclohexyl-1-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-[2-(3-methylimidazol-4-yl)ethynyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 134153452) has the molecular formula C28H39N5O5S and a molecular weight of 557.72 g/mol. Its IUPAC name is 3-cyclohexyl-1-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-[2-(3-methylimidazol-4-yl)ethynyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-cyclohexyl-1-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-[2-(3-methylimidazol-4-yl)ethynyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 134153452 |
| Molecular Formula | C28H39N5O5S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 3-cyclohexyl-1-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-[2-(3-methylimidazol-4-yl)ethynyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#Cc3cncn3C)cc2O[C@H]1CN(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H39N5O5S/c1-20-16-33(21(2)18-34)39(36,37)27-13-11-22(10-12-24-15-29-19-32(24)4)14-25(27)38-26(20)17-31(3)28(35)30-23-8-6-5-7-9-23/h11,13-15,19-21,23,26,34H,5-9,16-18H2,1-4H3,(H,30,35)/t20-,21+,26+/m1/s1 |
| InChIKey | QZLHGHQJQRCNHM-SWYRRKHMSA-N |
| XLogP | 2.56 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|