C21H17FO2 — CID 46904805
(5R)-5-(4-fluorophenyl)-3-[2-(2-methoxyphenyl)ethynyl]cyclohex-2-en-1-one (PubChem CID 46904805) has the molecular formula C21H17FO2 and a molecular weight of 320.36 g/mol. Its IUPAC name is (5R)-5-(4-fluorophenyl)-3-[2-(2-methoxyphenyl)ethynyl]cyclohex-2-en-1-one.
| Compound Name | (5R)-5-(4-fluorophenyl)-3-[2-(2-methoxyphenyl)ethynyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 46904805 |
| Molecular Formula | C21H17FO2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (5R)-5-(4-fluorophenyl)-3-[2-(2-methoxyphenyl)ethynyl]cyclohex-2-en-1-one |
| SMILES | COc1ccccc1C#CC1=CC(=O)C[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H17FO2/c1-24-21-5-3-2-4-17(21)7-6-15-12-18(14-20(23)13-15)16-8-10-19(22)11-9-16/h2-5,8-11,13,18H,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | SFQVVOCQVPATRD-GOSISDBHSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|