C14H27NO2 — CID 46905981
N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide (PubChem CID 46905981) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide.
| Compound Name | N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide |
|---|---|
| PubChem CID | 46905981 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide |
| SMILES | CCC/C=C\CCCC[C@H](O)[C@@H](C)NC(C)=O |
| InChI | InChI=1S/C14H27NO2/c1-4-5-6-7-8-9-10-11-14(17)12(2)15-13(3)16/h6-7,12,14,17H,4-5,8-11H2,1-3H3,(H,15,16)/b7-6-/t12-,14+/m1/s1 |
| InChIKey | YNBJXCBPPYCLMH-XBWLEZLWSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|