About [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate
[4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate (PubChem CID 46906297) has the molecular formula C19H16O2S3
and a molecular weight of 372.54 g/mol. Its IUPAC name is [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate.
Molecular Properties
| Compound Name | [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate |
| PubChem CID | 46906297 |
| Molecular Formula | C19H16O2S3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)Oc1ccc(-c2cssc2=S)cc1 |
| InChI | InChI=1S/C19H16O2S3/c20-18(8-4-7-14-5-2-1-3-6-14)21-16-11-9-15(10-12-16)17-13-23-24-19(17)22/h1-3,5-6,9-13H,4,7-8H2 |
| InChIKey | TYZMAGIVRQSVOR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate?
The IUPAC name of [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate (CID 46906297) is [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate.
What is the SMILES notation for [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate?
The canonical SMILES for [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate is O=C(CCCc1ccccc1)Oc1ccc(-c2cssc2=S)cc1.
What is the InChIKey of [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate?
The InChIKey is TYZMAGIVRQSVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O2S3/c20-18(8-4-7-14-5-2-1-3-6-14)21-16-11-9-15(10-12-16)17-13-23-24-19(17)22/h1-3,5-6,9-13H,4,7-8H2.
What are the key properties of [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate?
[4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate has a molecular weight of 372.54 g/mol, XLogP of 6.13, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-sulfanylidenedithiol-4-yl)phenyl] 4-phenylbutanoate is sourced from PubChem (CID 46906297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).