C13H10F3NO5S — CID 46907127
(5Z)-5-[(3-hydroxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 46907127) has the molecular formula C13H10F3NO5S and a molecular weight of 349.29 g/mol. Its IUPAC name is (5Z)-5-[(3-hydroxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-hydroxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46907127 |
| Molecular Formula | C13H10F3NO5S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (5Z)-5-[(3-hydroxyphenyl)methylidene]-3-(3,3,3-trifluoro-2,2-dihydroxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccc(O)c2)C(=O)N1CC(O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO5S/c14-13(15,16)12(21,22)6-17-10(19)9(23-11(17)20)5-7-2-1-3-8(18)4-7/h1-5,18,21-22H,6H2/b9-5- |
| InChIKey | VJNHSLSBNFMMME-UITAMQMPSA-N |
| XLogP | 1.67 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|