C21H23NO2 — CID 46907384
2-[1-(4,4-diphenylbut-3-enyl)azetidin-3-yl]acetic acid (PubChem CID 46907384) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[1-(4,4-diphenylbut-3-enyl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(4,4-diphenylbut-3-enyl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 46907384 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[1-(4,4-diphenylbut-3-enyl)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(CCC=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO2/c23-21(24)14-17-15-22(16-17)13-7-12-20(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-12,17H,7,13-16H2,(H,23,24) |
| InChIKey | SZBREYXZWYIOCV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |