C23H26N2O2 — CID 11689833
1-(4-cyano-4,4-diphenylbutyl)piperidine-4-carboxylic acid (PubChem CID 11689833) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(4-cyano-4,4-diphenylbutyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(4-cyano-4,4-diphenylbutyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11689833 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(4-cyano-4,4-diphenylbutyl)piperidine-4-carboxylic acid |
| SMILES | N#CC(CCCN1CCC(C(=O)O)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c24-18-23(20-8-3-1-4-9-20,21-10-5-2-6-11-21)14-7-15-25-16-12-19(13-17-25)22(26)27/h1-6,8-11,19H,7,12-17H2,(H,26,27) |
| InChIKey | SPPOCCZNANOPDP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |