C26H30N2O4 — CID 23723097
oxalic acid;2-(3-piperidin-1-ylpropyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbonitrile (PubChem CID 23723097) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is oxalic acid;2-(3-piperidin-1-ylpropyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbonitrile.
| Compound Name | oxalic acid;2-(3-piperidin-1-ylpropyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbonitrile |
|---|---|
| PubChem CID | 23723097 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | oxalic acid;2-(3-piperidin-1-ylpropyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbonitrile |
| SMILES | N#CC1(CCCN2CCCCC2)c2ccccc2CCc2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H28N2.C2H2O4/c25-19-24(15-8-18-26-16-6-1-7-17-26)22-11-4-2-9-20(22)13-14-21-10-3-5-12-23(21)24;3-1(4)2(5)6/h2-5,9-12H,1,6-8,13-18H2;(H,3,4)(H,5,6) |
| InChIKey | IUZKXQUCLGGLDO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|