C22H24N2O5 — CID 24840211
4-morpholin-4-yl-2,2-diphenylbutanenitrile;oxalic acid (PubChem CID 24840211) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-morpholin-4-yl-2,2-diphenylbutanenitrile;oxalic acid.
| Compound Name | 4-morpholin-4-yl-2,2-diphenylbutanenitrile;oxalic acid |
|---|---|
| PubChem CID | 24840211 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-morpholin-4-yl-2,2-diphenylbutanenitrile;oxalic acid |
| SMILES | N#CC(CCN1CCOCC1)(c1ccccc1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H22N2O.C2H2O4/c21-17-20(18-7-3-1-4-8-18,19-9-5-2-6-10-19)11-12-22-13-15-23-16-14-22;3-1(4)2(5)6/h1-10H,11-16H2;(H,3,4)(H,5,6) |
| InChIKey | QOMMDJIBDTVWEV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|