C31H37NO5 — CID 54586953
oxalic acid;1-[2-(3,3,3-triphenylpropoxy)ethyl]azepane (PubChem CID 54586953) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is oxalic acid;1-[2-(3,3,3-triphenylpropoxy)ethyl]azepane.
| Compound Name | oxalic acid;1-[2-(3,3,3-triphenylpropoxy)ethyl]azepane |
|---|---|
| PubChem CID | 54586953 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | oxalic acid;1-[2-(3,3,3-triphenylpropoxy)ethyl]azepane |
| SMILES | O=C(O)C(=O)O.c1ccc(C(CCOCCN2CCCCCC2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35NO.C2H2O4/c1-2-13-22-30(21-12-1)23-25-31-24-20-29(26-14-6-3-7-15-26,27-16-8-4-9-17-27)28-18-10-5-11-19-28;3-1(4)2(5)6/h3-11,14-19H,1-2,12-13,20-25H2;(H,3,4)(H,5,6) |
| InChIKey | POILEWJMSUIZKF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|