C18H27NO5 — CID 70686300
oxalic acid;1-[2-(3-phenylpropoxy)ethyl]piperidine (PubChem CID 70686300) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is oxalic acid;1-[2-(3-phenylpropoxy)ethyl]piperidine.
| Compound Name | oxalic acid;1-[2-(3-phenylpropoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 70686300 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | oxalic acid;1-[2-(3-phenylpropoxy)ethyl]piperidine |
| SMILES | O=C(O)C(=O)O.c1ccc(CCCOCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C16H25NO.C2H2O4/c1-3-8-16(9-4-1)10-7-14-18-15-13-17-11-5-2-6-12-17;3-1(4)2(5)6/h1,3-4,8-9H,2,5-7,10-15H2;(H,3,4)(H,5,6) |
| InChIKey | LOICLRGKKGIYDE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|