C22H30N2O4 — CID 24842566
2-cyclopentyl-2-phenyl-4-piperidin-1-ylbutanenitrile;oxalic acid (PubChem CID 24842566) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-cyclopentyl-2-phenyl-4-piperidin-1-ylbutanenitrile;oxalic acid.
| Compound Name | 2-cyclopentyl-2-phenyl-4-piperidin-1-ylbutanenitrile;oxalic acid |
|---|---|
| PubChem CID | 24842566 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-cyclopentyl-2-phenyl-4-piperidin-1-ylbutanenitrile;oxalic acid |
| SMILES | N#CC(CCN1CCCCC1)(c1ccccc1)C1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H28N2.C2H2O4/c21-17-20(19-11-5-6-12-19,18-9-3-1-4-10-18)13-16-22-14-7-2-8-15-22;3-1(4)2(5)6/h1,3-4,9-10,19H,2,5-8,11-16H2;(H,3,4)(H,5,6) |
| InChIKey | HJUSTFJLJWBOGT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|