C21H25NO4 — CID 90674647
4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid (PubChem CID 90674647) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid.
| Compound Name | 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 90674647 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid |
| SMILES | CN1CCC(c2cccc(Cc3ccccc3)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23N.C2H2O4/c1-20-12-10-18(11-13-20)19-9-5-8-17(15-19)14-16-6-3-2-4-7-16;3-1(4)2(5)6/h2-9,15,18H,10-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BNLRPDBDYYWBGV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|