4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid

C21H25NO4 — CID 90674647

IUPAC4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid
SMILESCN1CCC(c2cccc(Cc3ccccc3)c2)CC1.O=C(O)C(=O)O
InChIInChI=1S/C19H23N.C2H2O4/c1-20-12-10-18(11-13-20)19-9-5-8-17(15-19)14-16-6-3-2-4-7-16;3-1(4)2(5)6/h2-9,15,18H,10-14H2,1H3;(H,3,4)(H,5,6)
InChIKeyBNLRPDBDYYWBGV-UHFFFAOYSA-N
MW355.43 g/mol
LogP3.24
Rot. Bonds3

About 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid

4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid (PubChem CID 90674647) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid.

Molecular Properties

Compound Name4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid
PubChem CID90674647
Molecular FormulaC21H25NO4
Molecular Weight355.43 g/mol
Exact Mass355.18
IUPAC Name4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid
SMILESCN1CCC(c2cccc(Cc3ccccc3)c2)CC1.O=C(O)C(=O)O
InChIInChI=1S/C19H23N.C2H2O4/c1-20-12-10-18(11-13-20)19-9-5-8-17(15-19)14-16-6-3-2-4-7-16;3-1(4)2(5)6/h2-9,15,18H,10-14H2,1H3;(H,3,4)(H,5,6)
InChIKeyBNLRPDBDYYWBGV-UHFFFAOYSA-N
XLogP3.24
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.43
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid?
The IUPAC name of 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid (CID 90674647) is 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid.
What is the SMILES notation for 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid?
The canonical SMILES for 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid is CN1CCC(c2cccc(Cc3ccccc3)c2)CC1.O=C(O)C(=O)O.
What is the InChIKey of 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid?
The InChIKey is BNLRPDBDYYWBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N.C2H2O4/c1-20-12-10-18(11-13-20)19-9-5-8-17(15-19)14-16-6-3-2-4-7-16;3-1(4)2(5)6/h2-9,15,18H,10-14H2,1H3;(H,3,4)(H,5,6).
What are the key properties of 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid?
4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid has a molecular weight of 355.43 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-benzylphenyl)-1-methylpiperidine;oxalic acid is sourced from PubChem (CID 90674647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).