C25H38N2O4 — CID 90483895
1-cycloheptyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid (PubChem CID 90483895) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-cycloheptyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid.
| Compound Name | 1-cycloheptyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 90483895 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1-cycloheptyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc(C2CCC(N3CCN(C4CCCCCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H36N2.C2H2O4/c1-2-7-11-22(10-6-1)24-16-18-25(19-17-24)23-14-12-21(13-15-23)20-8-4-3-5-9-20;3-1(4)2(5)6/h3-5,8-9,21-23H,1-2,6-7,10-19H2;(H,3,4)(H,5,6) |
| InChIKey | CODUGYUYFWFKTB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|