C27H38N2O4 — CID 11224812
N-butyl-1-(4,4-diphenylbutyl)piperidin-4-amine;oxalic acid (PubChem CID 11224812) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-butyl-1-(4,4-diphenylbutyl)piperidin-4-amine;oxalic acid.
| Compound Name | N-butyl-1-(4,4-diphenylbutyl)piperidin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 11224812 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-butyl-1-(4,4-diphenylbutyl)piperidin-4-amine;oxalic acid |
| SMILES | CCCCNC1CCN(CCCC(c2ccccc2)c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H36N2.C2H2O4/c1-2-3-18-26-24-16-20-27(21-17-24)19-10-15-25(22-11-6-4-7-12-22)23-13-8-5-9-14-23;3-1(4)2(5)6/h4-9,11-14,24-26H,2-3,10,15-21H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KDOHABDPFWZYQX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|