C24H28N2O2 — CID 71454124
ethyl 1-(3-cyano-3,3-diphenylpropyl)piperidine-4-carboxylate (PubChem CID 71454124) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is ethyl 1-(3-cyano-3,3-diphenylpropyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-cyano-3,3-diphenylpropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 71454124 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | ethyl 1-(3-cyano-3,3-diphenylpropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N2O2/c1-2-28-23(27)20-13-16-26(17-14-20)18-15-24(19-25,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,20H,2,13-18H2,1H3 |
| InChIKey | PAMKTICGQZAPNI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |