C31H37ClN4O4S — CID 46908987
2-[2-(3-chloro-4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]-N-[6-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide (PubChem CID 46908987) has the molecular formula C31H37ClN4O4S and a molecular weight of 597.18 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]-N-[6-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide.
| Compound Name | 2-[2-(3-chloro-4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]-N-[6-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 46908987 |
| Molecular Formula | C31H37ClN4O4S |
| Molecular Weight | 597.18 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-[2-(3-chloro-4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]-N-[6-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCn3cccc3C2CC(=O)NC2CCc3cc(CN4CCOCC4)ccc3C2)cc1Cl |
| InChI | InChI=1S/C31H37ClN4O4S/c1-22-4-9-27(19-28(22)32)41(38,39)36-12-11-35-10-2-3-29(35)30(36)20-31(37)33-26-8-7-24-17-23(5-6-25(24)18-26)21-34-13-15-40-16-14-34/h2-6,9-10,17,19,26,30H,7-8,11-16,18,20-21H2,1H3,(H,33,37) |
| InChIKey | HEZPBCJFLJIMHS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |