C28H34N4O3S — CID 67135178
N-[6-(methylaminomethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]acetamide (PubChem CID 67135178) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[6-(methylaminomethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]acetamide.
| Compound Name | N-[6-(methylaminomethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 67135178 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-[6-(methylaminomethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]acetamide |
| SMILES | CNCc1ccc2c(c1)CCC(NC(=O)CC1c3cccn3CCN1S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C28H34N4O3S/c1-20-5-11-25(12-6-20)36(34,35)32-15-14-31-13-3-4-26(31)27(32)18-28(33)30-24-10-9-22-16-21(19-29-2)7-8-23(22)17-24/h3-8,11-13,16,24,27,29H,9-10,14-15,17-19H2,1-2H3,(H,30,33) |
| InChIKey | IYCILYWISTUDNW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |