C13H4Br4O6 — CID 46910047
methyl 4,5,6,7-tetrabromo-3,5'-dioxospiro[2-benzofuran-1,2'-furan]-3'-carboxylate (PubChem CID 46910047) has the molecular formula C13H4Br4O6 and a molecular weight of 575.79 g/mol. Its IUPAC name is methyl 4,5,6,7-tetrabromo-3,5'-dioxospiro[2-benzofuran-1,2'-furan]-3'-carboxylate.
| Compound Name | methyl 4,5,6,7-tetrabromo-3,5'-dioxospiro[2-benzofuran-1,2'-furan]-3'-carboxylate |
|---|---|
| PubChem CID | 46910047 |
| Molecular Formula | C13H4Br4O6 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 571.67 |
| IUPAC Name | methyl 4,5,6,7-tetrabromo-3,5'-dioxospiro[2-benzofuran-1,2'-furan]-3'-carboxylate |
| SMILES | COC(=O)C1=CC(=O)OC12OC(=O)c1c(Br)c(Br)c(Br)c(Br)c12 |
| InChI | InChI=1S/C13H4Br4O6/c1-21-11(19)3-2-4(18)22-13(3)6-5(12(20)23-13)7(14)9(16)10(17)8(6)15/h2H,1H3 |
| InChIKey | SPBCMDXZBHQWKH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|