C7H9NO3 — CID 123657505
2,2-dimethyl-5-oxofuran-3-carboxamide (PubChem CID 123657505) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 2,2-dimethyl-5-oxofuran-3-carboxamide.
| Compound Name | 2,2-dimethyl-5-oxofuran-3-carboxamide |
|---|---|
| PubChem CID | 123657505 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 2,2-dimethyl-5-oxofuran-3-carboxamide |
| SMILES | CC1(C)OC(=O)C=C1C(N)=O |
| InChI | InChI=1S/C7H9NO3/c1-7(2)4(6(8)10)3-5(9)11-7/h3H,1-2H3,(H2,8,10) |
| InChIKey | BTQIKKGAKFQDAF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |