(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate

C11H11NO4 — CID 86138313

IUPAC(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate
SMILESCC1(C)Oc2c(OC(N)=O)cccc2C1=O
InChIInChI=1S/C11H11NO4/c1-11(2)9(13)6-4-3-5-7(8(6)16-11)15-10(12)14/h3-5H,1-2H3,(H2,12,14)
InChIKeyRTVGMIZMMVFDAV-UHFFFAOYSA-N
MW221.21 g/mol
LogP1.50
Rot. Bonds1

About (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate

(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate (PubChem CID 86138313) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate.

Molecular Properties

Compound Name(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate
PubChem CID86138313
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate
SMILESCC1(C)Oc2c(OC(N)=O)cccc2C1=O
InChIInChI=1S/C11H11NO4/c1-11(2)9(13)6-4-3-5-7(8(6)16-11)15-10(12)14/h3-5H,1-2H3,(H2,12,14)
InChIKeyRTVGMIZMMVFDAV-UHFFFAOYSA-N
XLogP1.50
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate?
The IUPAC name of (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate (CID 86138313) is (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate.
What is the SMILES notation for (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate?
The canonical SMILES for (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate is CC1(C)Oc2c(OC(N)=O)cccc2C1=O.
What is the InChIKey of (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate?
The InChIKey is RTVGMIZMMVFDAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-11(2)9(13)6-4-3-5-7(8(6)16-11)15-10(12)14/h3-5H,1-2H3,(H2,12,14).
What are the key properties of (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate?
(2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate has a molecular weight of 221.21 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3-oxo-1-benzofuran-7-yl) carbamate is sourced from PubChem (CID 86138313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).