C17H13Cl6F3N4OS — CID 46910348
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[[2,2,2-trichloro-1-(2-chloroethoxy)ethyl]amino]pyrazole-3-carbonitrile (PubChem CID 46910348) has the molecular formula C17H13Cl6F3N4OS and a molecular weight of 591.10 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[[2,2,2-trichloro-1-(2-chloroethoxy)ethyl]amino]pyrazole-3-carbonitrile.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[[2,2,2-trichloro-1-(2-chloroethoxy)ethyl]amino]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 46910348 |
| Molecular Formula | C17H13Cl6F3N4OS |
| Molecular Weight | 591.10 g/mol |
| Exact Mass | 587.89 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfanyl-5-[[2,2,2-trichloro-1-(2-chloroethoxy)ethyl]amino]pyrazole-3-carbonitrile |
| SMILES | CCSc1c(C#N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1NC(OCCCl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H13Cl6F3N4OS/c1-2-32-13-11(7-27)29-30(14(13)28-15(16(21,22)23)31-4-3-18)12-9(19)5-8(6-10(12)20)17(24,25)26/h5-6,15,28H,2-4H2,1H3 |
| InChIKey | RMRVWABAPIZXKQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.10 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|