C19H35Br2ClN2O — CID 46911005
2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]ethyl-trimethylazanium chloride (PubChem CID 46911005) has the molecular formula C19H35Br2ClN2O and a molecular weight of 502.76 g/mol. Its IUPAC name is 2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]ethyl-trimethylazanium chloride.
| Compound Name | 2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]ethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 46911005 |
| Molecular Formula | C19H35Br2ClN2O |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]ethyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCNC(=O)/C=C/CCCCCCCCCC=C(Br)Br.[Cl-] |
| InChI | InChI=1S/C19H34Br2N2O.ClH/c1-23(2,3)17-16-22-19(24)15-13-11-9-7-5-4-6-8-10-12-14-18(20)21;/h13-15H,4-12,16-17H2,1-3H3;1H/b15-13+; |
| InChIKey | WOLYRWLYKIFPBO-GVYCEHEKSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|