C22H17ClF3N5O3 — CID 46911579
4-[(1R,2R,6S,7R)-9-(6-chloropyrimidin-4-yl)-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 46911579) has the molecular formula C22H17ClF3N5O3 and a molecular weight of 491.86 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7R)-9-(6-chloropyrimidin-4-yl)-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2R,6S,7R)-9-(6-chloropyrimidin-4-yl)-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 46911579 |
| Molecular Formula | C22H17ClF3N5O3 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 4-[(1R,2R,6S,7R)-9-(6-chloropyrimidin-4-yl)-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@]12CN(c3cc(Cl)ncn3)C[C@](C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H17ClF3N5O3/c1-20-8-30(15-6-14(23)28-10-29-15)9-21(2,34-20)17-16(20)18(32)31(19(17)33)12-4-3-11(7-27)13(5-12)22(24,25)26/h3-6,10,16-17H,8-9H2,1-2H3/t16-,17+,20-,21-/m0/s1 |
| InChIKey | JQJNXDWUNGIPJK-JWWGGVBKSA-N |
| XLogP | 3.19 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|