C24H19ClF3N3O4 — CID 58745908
4-[(3aR,4S,5S,7R,7aS)-5-[(6-chloro-2-pyridinyl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58745908) has the molecular formula C24H19ClF3N3O4 and a molecular weight of 505.88 g/mol. Its IUPAC name is 4-[(3aR,4S,5S,7R,7aS)-5-[(6-chloro-2-pyridinyl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,5S,7R,7aS)-5-[(6-chloro-2-pyridinyl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58745908 |
| Molecular Formula | C24H19ClF3N3O4 |
| Molecular Weight | 505.88 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-[(3aR,4S,5S,7R,7aS)-5-[(6-chloro-2-pyridinyl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12O[C@](C)(C[C@H]1COc1cccc(Cl)n1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H19ClF3N3O4/c1-22-9-13(11-34-17-5-3-4-16(25)30-17)23(2,35-22)19-18(22)20(32)31(21(19)33)14-7-6-12(10-29)15(8-14)24(26,27)28/h3-8,13,18-19H,9,11H2,1-2H3/t13-,18+,19-,22+,23-/m0/s1 |
| InChIKey | QMKPDLCJCNELHZ-KFYMUARQSA-N |
| XLogP | 4.38 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|