C24H20F4N4O4 — CID 58746113
4-[(3aR,4S,5S,7R,7aS)-5-[(5-fluoro-6-methylpyrimidin-4-yl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58746113) has the molecular formula C24H20F4N4O4 and a molecular weight of 504.44 g/mol. Its IUPAC name is 4-[(3aR,4S,5S,7R,7aS)-5-[(5-fluoro-6-methylpyrimidin-4-yl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,5S,7R,7aS)-5-[(5-fluoro-6-methylpyrimidin-4-yl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58746113 |
| Molecular Formula | C24H20F4N4O4 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-[(3aR,4S,5S,7R,7aS)-5-[(5-fluoro-6-methylpyrimidin-4-yl)oxymethyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1ncnc(OC[C@@H]2C[C@@]3(C)O[C@]2(C)[C@@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)[C@@H]23)c1F |
| InChI | InChI=1S/C24H20F4N4O4/c1-11-18(25)19(31-10-30-11)35-9-13-7-22(2)16-17(23(13,3)36-22)21(34)32(20(16)33)14-5-4-12(8-29)15(6-14)24(26,27)28/h4-6,10,13,16-17H,7,9H2,1-3H3/t13-,16+,17-,22+,23-/m0/s1 |
| InChIKey | GYFUZBQRFAIIAX-PYKAKHIASA-N |
| XLogP | 3.57 |
| TPSA | 105.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|