About (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate
(4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate (PubChem CID 46913138) has the molecular formula C12H12N2O8
and a molecular weight of 312.23 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate |
| PubChem CID | 46913138 |
| Molecular Formula | C12H12N2O8 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate |
| SMILES | CC(=O)Nc1ccc(OC(=O)COC(=O)CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N2O8/c1-8(15)13-9-2-4-10(5-3-9)22-12(17)6-20-11(16)7-21-14(18)19/h2-5H,6-7H2,1H3,(H,13,15) |
| InChIKey | AFXDIRGHMZCFCK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate?
The IUPAC name of (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate (CID 46913138) is (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate.
What is the SMILES notation for (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate?
The canonical SMILES for (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate is CC(=O)Nc1ccc(OC(=O)COC(=O)CO[N+](=O)[O-])cc1.
What is the InChIKey of (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate?
The InChIKey is AFXDIRGHMZCFCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O8/c1-8(15)13-9-2-4-10(5-3-9)22-12(17)6-20-11(16)7-21-14(18)19/h2-5H,6-7H2,1H3,(H,13,15).
What are the key properties of (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate?
(4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate has a molecular weight of 312.23 g/mol, XLogP of 0.30, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-(2-nitrooxyacetyl)oxyacetate is sourced from PubChem (CID 46913138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).