C14H18O6 — CID 46915617
6-[3-(2-ethenyl-1,3-dioxolan-2-yl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 46915617) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 6-[3-(2-ethenyl-1,3-dioxolan-2-yl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[3-(2-ethenyl-1,3-dioxolan-2-yl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 46915617 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-[3-(2-ethenyl-1,3-dioxolan-2-yl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=CC1(CC(=O)CC2=CC(=O)OC(C)(C)O2)OCCO1 |
| InChI | InChI=1S/C14H18O6/c1-4-14(17-5-6-18-14)9-10(15)7-11-8-12(16)20-13(2,3)19-11/h4,8H,1,5-7,9H2,2-3H3 |
| InChIKey | KAMGPIKWLWUIKM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|