C15H23N5O2 — CID 46915808
tert-butyl N-[(2-cyano-5-methylpyrimidin-4-yl)-(2-methylpropyl)amino]carbamate (PubChem CID 46915808) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is tert-butyl N-[(2-cyano-5-methylpyrimidin-4-yl)-(2-methylpropyl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-cyano-5-methylpyrimidin-4-yl)-(2-methylpropyl)amino]carbamate |
|---|---|
| PubChem CID | 46915808 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | tert-butyl N-[(2-cyano-5-methylpyrimidin-4-yl)-(2-methylpropyl)amino]carbamate |
| SMILES | Cc1cnc(C#N)nc1N(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N5O2/c1-10(2)9-20(19-14(21)22-15(4,5)6)13-11(3)8-17-12(7-16)18-13/h8,10H,9H2,1-6H3,(H,19,21) |
| InChIKey | ATULKCOUKNUIGH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|