C14H20ClN5O2 — CID 46914908
tert-butyl N-[(4-chloro-5-cyanopyrimidin-2-yl)-(2-methylpropyl)amino]carbamate (PubChem CID 46914908) has the molecular formula C14H20ClN5O2 and a molecular weight of 325.80 g/mol. Its IUPAC name is tert-butyl N-[(4-chloro-5-cyanopyrimidin-2-yl)-(2-methylpropyl)amino]carbamate.
| Compound Name | tert-butyl N-[(4-chloro-5-cyanopyrimidin-2-yl)-(2-methylpropyl)amino]carbamate |
|---|---|
| PubChem CID | 46914908 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | tert-butyl N-[(4-chloro-5-cyanopyrimidin-2-yl)-(2-methylpropyl)amino]carbamate |
| SMILES | CC(C)CN(NC(=O)OC(C)(C)C)c1ncc(C#N)c(Cl)n1 |
| InChI | InChI=1S/C14H20ClN5O2/c1-9(2)8-20(19-13(21)22-14(3,4)5)12-17-7-10(6-16)11(15)18-12/h7,9H,8H2,1-5H3,(H,19,21) |
| InChIKey | RWVCFROLNWYPGD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|